C20H25N3O6S — CID 4552183
ethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4552183) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is ethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4552183 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | ethyl 2-[1-[3-(3,4-dimethoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O6S/c1-4-29-18(25)12-14-19(26)21-9-10-23(14)20(30)22-17(24)8-6-13-5-7-15(27-2)16(11-13)28-3/h5-8,11,14H,4,9-10,12H2,1-3H3,(H,21,26)(H,22,24,30) |
| InChIKey | APGUNLUZIIKWMP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|