C23H31N3O6S — CID 17079987
3-methylbutyl 2-[1-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17079987) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is 3-methylbutyl 2-[1-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[1-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17079987 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-methylbutyl 2-[1-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCCC(C)C)cc1OC |
| InChI | InChI=1S/C23H31N3O6S/c1-15(2)9-12-32-21(28)14-17-22(29)24-10-11-26(17)23(33)25-20(27)8-6-16-5-7-18(30-3)19(13-16)31-4/h5-8,13,15,17H,9-12,14H2,1-4H3,(H,24,29)(H,25,27,33)/b8-6+ |
| InChIKey | CLIWLLMJYBNCLC-SOFGYWHQSA-N |
| XLogP | 1.90 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|