C19H24BrN3O4S — CID 54791640
3-methylbutyl 2-[1-[(4-bromobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54791640) has the molecular formula C19H24BrN3O4S and a molecular weight of 470.39 g/mol. Its IUPAC name is 3-methylbutyl 2-[1-[(4-bromobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[1-[(4-bromobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54791640 |
| Molecular Formula | C19H24BrN3O4S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 3-methylbutyl 2-[1-[(4-bromobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)CCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrN3O4S/c1-12(2)7-10-27-16(24)11-15-18(26)21-8-9-23(15)19(28)22-17(25)13-3-5-14(20)6-4-13/h3-6,12,15H,7-11H2,1-2H3,(H,21,26)(H,22,25,28) |
| InChIKey | AQZIJRUIMMJUQL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|