C20H27N3O5S — CID 8757290
propyl 2-[(2R)-3-oxo-1-[(4-propoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 8757290) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is propyl 2-[(2R)-3-oxo-1-[(4-propoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | propyl 2-[(2R)-3-oxo-1-[(4-propoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 8757290 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | propyl 2-[(2R)-3-oxo-1-[(4-propoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCCOC(=O)C[C@@H]1C(=O)NCCN1C(=S)NC(=O)c1ccc(OCCC)cc1 |
| InChI | InChI=1S/C20H27N3O5S/c1-3-11-27-15-7-5-14(6-8-15)18(25)22-20(29)23-10-9-21-19(26)16(23)13-17(24)28-12-4-2/h5-8,16H,3-4,9-13H2,1-2H3,(H,21,26)(H,22,25,29)/t16-/m1/s1 |
| InChIKey | HWVXNBZRDYLDNJ-MRXNPFEDSA-N |
| XLogP | 1.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|