C22H31N3O6S — CID 4959386
2-methoxyethyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 4959386) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959386 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-methoxyethyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCCOC)cc1 |
| InChI | InChI=1S/C22H31N3O6S/c1-3-4-5-12-30-17-8-6-16(7-9-17)20(27)24-22(32)25-11-10-23-21(28)18(25)15-19(26)31-14-13-29-2/h6-9,18H,3-5,10-15H2,1-2H3,(H,23,28)(H,24,27,32) |
| InChIKey | NVUCKNURFZWPLT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|