C26H37N3O6S — CID 17178625
methyl 4-[[2-(2-decoxy-2-oxoethyl)-3-oxopiperazine-1-carbothioyl]carbamoyl]benzoate (PubChem CID 17178625) has the molecular formula C26H37N3O6S and a molecular weight of 519.66 g/mol. Its IUPAC name is methyl 4-[[2-(2-decoxy-2-oxoethyl)-3-oxopiperazine-1-carbothioyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-(2-decoxy-2-oxoethyl)-3-oxopiperazine-1-carbothioyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17178625 |
| Molecular Formula | C26H37N3O6S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | methyl 4-[[2-(2-decoxy-2-oxoethyl)-3-oxopiperazine-1-carbothioyl]carbamoyl]benzoate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C26H37N3O6S/c1-3-4-5-6-7-8-9-10-17-35-22(30)18-21-24(32)27-15-16-29(21)26(36)28-23(31)19-11-13-20(14-12-19)25(33)34-2/h11-14,21H,3-10,15-18H2,1-2H3,(H,27,32)(H,28,31,36) |
| InChIKey | IPBYRFOGAFTCDB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|