C25H37N3O4S — CID 17094121
decyl 2-[1-[(4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17094121) has the molecular formula C25H37N3O4S and a molecular weight of 475.66 g/mol. Its IUPAC name is decyl 2-[1-[(4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[(4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094121 |
| Molecular Formula | C25H37N3O4S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | decyl 2-[1-[(4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H37N3O4S/c1-3-4-5-6-7-8-9-10-17-32-22(29)18-21-24(31)26-15-16-28(21)25(33)27-23(30)20-13-11-19(2)12-14-20/h11-14,21H,3-10,15-18H2,1-2H3,(H,26,31)(H,27,30,33) |
| InChIKey | RZGFFKLIKJZHDM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|