C24H35N3O6S — CID 4959398
2-methoxyethyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4959398) has the molecular formula C24H35N3O6S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-methoxyethyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959398 |
| Molecular Formula | C24H35N3O6S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-methoxyethyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCCOC)cc1 |
| InChI | InChI=1S/C24H35N3O6S/c1-3-4-5-6-7-14-32-19-10-8-18(9-11-19)22(29)26-24(34)27-13-12-25-23(30)20(27)17-21(28)33-16-15-31-2/h8-11,20H,3-7,12-17H2,1-2H3,(H,25,30)(H,26,29,34) |
| InChIKey | VWCSLHMEHHLYFD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|