C26H37N3O5S — CID 4934173
cyclohexyl 2-[1-[(4-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4934173) has the molecular formula C26H37N3O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is cyclohexyl 2-[1-[(4-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[1-[(4-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4934173 |
| Molecular Formula | C26H37N3O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | cyclohexyl 2-[1-[(4-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H37N3O5S/c1-2-3-4-8-17-33-20-13-11-19(12-14-20)24(31)28-26(35)29-16-15-27-25(32)22(29)18-23(30)34-21-9-6-5-7-10-21/h11-14,21-22H,2-10,15-18H2,1H3,(H,27,32)(H,28,31,35) |
| InChIKey | VIZXKXPAIRCPGG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|