C28H35N3O5S — CID 4950964
benzyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4950964) has the molecular formula C28H35N3O5S and a molecular weight of 525.67 g/mol. Its IUPAC name is benzyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4950964 |
| Molecular Formula | C28H35N3O5S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | benzyl 2-[1-[(4-heptoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35N3O5S/c1-2-3-4-5-9-18-35-23-14-12-22(13-15-23)26(33)30-28(37)31-17-16-29-27(34)24(31)19-25(32)36-20-21-10-7-6-8-11-21/h6-8,10-15,24H,2-5,9,16-20H2,1H3,(H,29,34)(H,30,33,37) |
| InChIKey | ILKJYOOCYPXYMT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|