C30H31N3O5S — CID 4956980
2-phenylethyl 2-[3-oxo-1-[[4-(2-phenylethoxy)benzoyl]carbamothioyl]piperazin-2-yl]acetate (PubChem CID 4956980) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is 2-phenylethyl 2-[3-oxo-1-[[4-(2-phenylethoxy)benzoyl]carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[3-oxo-1-[[4-(2-phenylethoxy)benzoyl]carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4956980 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 2-phenylethyl 2-[3-oxo-1-[[4-(2-phenylethoxy)benzoyl]carbamothioyl]piperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(OCCc2ccccc2)cc1)OCCc1ccccc1 |
| InChI | InChI=1S/C30H31N3O5S/c34-27(38-20-16-23-9-5-2-6-10-23)21-26-29(36)31-17-18-33(26)30(39)32-28(35)24-11-13-25(14-12-24)37-19-15-22-7-3-1-4-8-22/h1-14,26H,15-21H2,(H,31,36)(H,32,35,39) |
| InChIKey | SOWKTKRKIXHMJQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|