C25H35N3O5S — CID 4935904
cyclohexyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 4935904) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is cyclohexyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4935904 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | cyclohexyl 2-[3-oxo-1-[(4-pentoxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H35N3O5S/c1-2-3-7-16-32-19-12-10-18(11-13-19)23(30)27-25(34)28-15-14-26-24(31)21(28)17-22(29)33-20-8-5-4-6-9-20/h10-13,20-21H,2-9,14-17H2,1H3,(H,26,31)(H,27,30,34) |
| InChIKey | YXZXGKSSMHBQQA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|