C27H33N3O5S — CID 4942652
benzyl 2-[1-[(2-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4942652) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is benzyl 2-[1-[(2-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-[(2-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4942652 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | benzyl 2-[1-[(2-hexoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33N3O5S/c1-2-3-4-10-17-34-23-14-9-8-13-21(23)25(32)29-27(36)30-16-15-28-26(33)22(30)18-24(31)35-19-20-11-6-5-7-12-20/h5-9,11-14,22H,2-4,10,15-19H2,1H3,(H,28,33)(H,29,32,36) |
| InChIKey | YAKSZPPIDYDLKU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|