C25H37N3O5S — CID 17094132
decyl 2-[1-[(2-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17094132) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is decyl 2-[1-[(2-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[(2-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094132 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | decyl 2-[1-[(2-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C25H37N3O5S/c1-3-4-5-6-7-8-9-12-17-33-22(29)18-20-24(31)26-15-16-28(20)25(34)27-23(30)19-13-10-11-14-21(19)32-2/h10-11,13-14,20H,3-9,12,15-18H2,1-2H3,(H,26,31)(H,27,30,34) |
| InChIKey | MEHVMUCFNBTTOE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|