C24H34ClN3O4S — CID 17094098
decyl 2-[1-[(2-chlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17094098) has the molecular formula C24H34ClN3O4S and a molecular weight of 496.07 g/mol. Its IUPAC name is decyl 2-[1-[(2-chlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[(2-chlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094098 |
| Molecular Formula | C24H34ClN3O4S |
| Molecular Weight | 496.07 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | decyl 2-[1-[(2-chlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C24H34ClN3O4S/c1-2-3-4-5-6-7-8-11-16-32-21(29)17-20-23(31)26-14-15-28(20)24(33)27-22(30)18-12-9-10-13-19(18)25/h9-10,12-13,20H,2-8,11,14-17H2,1H3,(H,26,31)(H,27,30,33) |
| InChIKey | QXRCIDPIRGWQNJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|