C22H33N3O4S2 — CID 17094105
decyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate (PubChem CID 17094105) has the molecular formula C22H33N3O4S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is decyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate.
| Compound Name | decyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094105 |
| Molecular Formula | C22H33N3O4S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | decyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C22H33N3O4S2/c1-2-3-4-5-6-7-8-9-14-29-19(26)16-17-20(27)23-12-13-25(17)22(30)24-21(28)18-11-10-15-31-18/h10-11,15,17H,2-9,12-14,16H2,1H3,(H,23,27)(H,24,28,30) |
| InChIKey | FYVDBDGYONKWHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|