C18H23N3O4S2 — CID 4946188
cyclohexyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate (PubChem CID 4946188) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is cyclohexyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4946188 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | cyclohexyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=S)NC(=O)c1cccs1)OC1CCCCC1 |
| InChI | InChI=1S/C18H23N3O4S2/c22-15(25-12-5-2-1-3-6-12)11-13-16(23)19-8-9-21(13)18(26)20-17(24)14-7-4-10-27-14/h4,7,10,12-13H,1-3,5-6,8-9,11H2,(H,19,23)(H,20,24,26) |
| InChIKey | KFLUXBQKIBUWNO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|