C21H26IN3O4S — CID 4946235
cyclohexyl 2-[1-[(3-iodo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4946235) has the molecular formula C21H26IN3O4S and a molecular weight of 543.43 g/mol. Its IUPAC name is cyclohexyl 2-[1-[(3-iodo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[1-[(3-iodo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4946235 |
| Molecular Formula | C21H26IN3O4S |
| Molecular Weight | 543.43 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | cyclohexyl 2-[1-[(3-iodo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | Cc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OC2CCCCC2)cc1I |
| InChI | InChI=1S/C21H26IN3O4S/c1-13-7-8-14(11-16(13)22)19(27)24-21(30)25-10-9-23-20(28)17(25)12-18(26)29-15-5-3-2-4-6-15/h7-8,11,15,17H,2-6,9-10,12H2,1H3,(H,23,28)(H,24,27,30) |
| InChIKey | FNSRVPSKPDYPSO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|