C19H24IN3O5S — CID 17097109
butan-2-yl 2-[1-[(3-iodo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17097109) has the molecular formula C19H24IN3O5S and a molecular weight of 533.39 g/mol. Its IUPAC name is butan-2-yl 2-[1-[(3-iodo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-[(3-iodo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17097109 |
| Molecular Formula | C19H24IN3O5S |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | butan-2-yl 2-[1-[(3-iodo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(OC)c(I)c1 |
| InChI | InChI=1S/C19H24IN3O5S/c1-4-11(2)28-16(24)10-14-18(26)21-7-8-23(14)19(29)22-17(25)12-5-6-15(27-3)13(20)9-12/h5-6,9,11,14H,4,7-8,10H2,1-3H3,(H,21,26)(H,22,25,29) |
| InChIKey | MWOBAYRIZYKBFN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|