C15H23N3O4S — CID 17097118
butan-2-yl 2-[1-(cyclopropanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17097118) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is butan-2-yl 2-[1-(cyclopropanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-(cyclopropanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17097118 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | butan-2-yl 2-[1-(cyclopropanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C1CC1 |
| InChI | InChI=1S/C15H23N3O4S/c1-3-9(2)22-12(19)8-11-14(21)16-6-7-18(11)15(23)17-13(20)10-4-5-10/h9-11H,3-8H2,1-2H3,(H,16,21)(H,17,20,23) |
| InChIKey | FZXZIXPVTFMVHR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|