C14H23N3O4S — CID 9298360
butyl 2-[(2S)-3-oxo-1-(propanoylcarbamothioyl)piperazin-2-yl]acetate (PubChem CID 9298360) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is butyl 2-[(2S)-3-oxo-1-(propanoylcarbamothioyl)piperazin-2-yl]acetate.
| Compound Name | butyl 2-[(2S)-3-oxo-1-(propanoylcarbamothioyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9298360 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | butyl 2-[(2S)-3-oxo-1-(propanoylcarbamothioyl)piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)C[C@H]1C(=O)NCCN1C(=S)NC(=O)CC |
| InChI | InChI=1S/C14H23N3O4S/c1-3-5-8-21-12(19)9-10-13(20)15-6-7-17(10)14(22)16-11(18)4-2/h10H,3-9H2,1-2H3,(H,15,20)(H,16,18,22)/t10-/m0/s1 |
| InChIKey | MYMPEXJDGUSSQQ-JTQLQIEISA-N |
| XLogP | 0.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|