C24H41N3O4S — CID 17094120
decyl 2-[1-(cyclohexanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17094120) has the molecular formula C24H41N3O4S and a molecular weight of 467.68 g/mol. Its IUPAC name is decyl 2-[1-(cyclohexanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(cyclohexanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094120 |
| Molecular Formula | C24H41N3O4S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | decyl 2-[1-(cyclohexanecarbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H41N3O4S/c1-2-3-4-5-6-7-8-12-17-31-21(28)18-20-23(30)25-15-16-27(20)24(32)26-22(29)19-13-10-9-11-14-19/h19-20H,2-18H2,1H3,(H,25,30)(H,26,29,32) |
| InChIKey | QZTSUHKJSOAERH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|