C23H40N2O4 — CID 17093877
decyl 2-[1-(cyclohexanecarbonyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17093877) has the molecular formula C23H40N2O4 and a molecular weight of 408.58 g/mol. Its IUPAC name is decyl 2-[1-(cyclohexanecarbonyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(cyclohexanecarbonyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093877 |
| Molecular Formula | C23H40N2O4 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | decyl 2-[1-(cyclohexanecarbonyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H40N2O4/c1-2-3-4-5-6-7-8-12-17-29-21(26)18-20-22(27)24-15-16-25(20)23(28)19-13-10-9-11-14-19/h19-20H,2-18H2,1H3,(H,24,27) |
| InChIKey | GMHBRIILOBBTNT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|