C13H21BrN2O4 — CID 93083224
pentyl 2-[(2S)-1-(2-bromoacetyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 93083224) has the molecular formula C13H21BrN2O4 and a molecular weight of 349.23 g/mol. Its IUPAC name is pentyl 2-[(2S)-1-(2-bromoacetyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | pentyl 2-[(2S)-1-(2-bromoacetyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 93083224 |
| Molecular Formula | C13H21BrN2O4 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | pentyl 2-[(2S)-1-(2-bromoacetyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)C[C@H]1C(=O)NCCN1C(=O)CBr |
| InChI | InChI=1S/C13H21BrN2O4/c1-2-3-4-7-20-12(18)8-10-13(19)15-5-6-16(10)11(17)9-14/h10H,2-9H2,1H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | TVHUDMZCPUKKNR-JTQLQIEISA-N |
| XLogP | 0.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|