C25H38N2O5 — CID 17093864
decyl 2-[1-[2-(4-methoxyphenyl)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17093864) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is decyl 2-[1-[2-(4-methoxyphenyl)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[2-(4-methoxyphenyl)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093864 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | decyl 2-[1-[2-(4-methoxyphenyl)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H38N2O5/c1-3-4-5-6-7-8-9-10-17-32-24(29)19-22-25(30)26-15-16-27(22)23(28)18-20-11-13-21(31-2)14-12-20/h11-14,22H,3-10,15-19H2,1-2H3,(H,26,30) |
| InChIKey | XMKVHPCBPRRSPC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|