C28H38N2O4 — CID 17093892
decyl 2-[1-(2-naphthalen-1-ylacetyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17093892) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is decyl 2-[1-(2-naphthalen-1-ylacetyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(2-naphthalen-1-ylacetyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17093892 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | decyl 2-[1-(2-naphthalen-1-ylacetyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H38N2O4/c1-2-3-4-5-6-7-8-11-19-34-27(32)21-25-28(33)29-17-18-30(25)26(31)20-23-15-12-14-22-13-9-10-16-24(22)23/h9-10,12-16,25H,2-8,11,17-21H2,1H3,(H,29,33) |
| InChIKey | QBOJEAUNPRAPBO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|