C24H27Cl2N3O4 — CID 54789910
butyl 2-[1-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54789910) has the molecular formula C24H27Cl2N3O4 and a molecular weight of 492.40 g/mol. Its IUPAC name is butyl 2-[1-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54789910 |
| Molecular Formula | C24H27Cl2N3O4 |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | butyl 2-[1-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H27Cl2N3O4/c1-2-3-13-33-22(31)15-20-24(32)27-11-12-29(20)21(30)14-16-7-4-5-10-19(16)28-23-17(25)8-6-9-18(23)26/h4-10,20,28H,2-3,11-15H2,1H3,(H,27,32) |
| InChIKey | QTHKTIZGNAMDTH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|