C19H27N3O4 — CID 54813759
butyl 2-[1-[2-(benzylamino)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54813759) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is butyl 2-[1-[2-(benzylamino)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-(benzylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54813759 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | butyl 2-[1-[2-(benzylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNCc1ccccc1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-3-11-26-18(24)12-16-19(25)21-9-10-22(16)17(23)14-20-13-15-7-5-4-6-8-15/h4-8,16,20H,2-3,9-14H2,1H3,(H,21,25) |
| InChIKey | JOMFIICPIATMBX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|