C26H33N3O6 — CID 54827027
butyl 2-[3-oxo-1-[2-[2-(2-phenoxyethoxy)anilino]acetyl]piperazin-2-yl]acetate (PubChem CID 54827027) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is butyl 2-[3-oxo-1-[2-[2-(2-phenoxyethoxy)anilino]acetyl]piperazin-2-yl]acetate.
| Compound Name | butyl 2-[3-oxo-1-[2-[2-(2-phenoxyethoxy)anilino]acetyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54827027 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | butyl 2-[3-oxo-1-[2-[2-(2-phenoxyethoxy)anilino]acetyl]piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C26H33N3O6/c1-2-3-15-35-25(31)18-22-26(32)27-13-14-29(22)24(30)19-28-21-11-7-8-12-23(21)34-17-16-33-20-9-5-4-6-10-20/h4-12,22,28H,2-3,13-19H2,1H3,(H,27,32) |
| InChIKey | CJTBIIVXCMKYOG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|