C22H27N3O4 — CID 54809104
butyl 2-[1-[2-(naphthalen-1-ylamino)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54809104) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is butyl 2-[1-[2-(naphthalen-1-ylamino)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-(naphthalen-1-ylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54809104 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | butyl 2-[1-[2-(naphthalen-1-ylamino)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc2ccccc12 |
| InChI | InChI=1S/C22H27N3O4/c1-2-3-13-29-21(27)14-19-22(28)23-11-12-25(19)20(26)15-24-18-10-6-8-16-7-4-5-9-17(16)18/h4-10,19,24H,2-3,11-15H2,1H3,(H,23,28) |
| InChIKey | PTIJNLDDEABWCG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|