C26H32N4O5 — CID 54842995
butyl 2-[1-[2-[3-(benzylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54842995) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is butyl 2-[1-[2-[3-(benzylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[3-(benzylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54842995 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | butyl 2-[1-[2-[3-(benzylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C26H32N4O5/c1-2-3-14-35-24(32)16-22-26(34)27-12-13-30(22)23(31)18-28-21-11-7-10-20(15-21)25(33)29-17-19-8-5-4-6-9-19/h4-11,15,22,28H,2-3,12-14,16-18H2,1H3,(H,27,34)(H,29,33) |
| InChIKey | BQVXTMMCHNQAGO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|