C21H30N4O6 — CID 54836037
propyl 2-[1-[2-[3-(2-methoxyethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54836037) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is propyl 2-[1-[2-[3-(2-methoxyethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-[3-(2-methoxyethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54836037 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | propyl 2-[1-[2-[3-(2-methoxyethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C21H30N4O6/c1-3-10-31-19(27)13-17-21(29)22-7-9-25(17)18(26)14-24-16-6-4-5-15(12-16)20(28)23-8-11-30-2/h4-6,12,17,24H,3,7-11,13-14H2,1-2H3,(H,22,29)(H,23,28) |
| InChIKey | PXPTUPTYFONPEL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|