C24H36N4O5 — CID 54840999
butyl 2-[1-[2-[3-(hexanoylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54840999) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is butyl 2-[1-[2-[3-(hexanoylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[3-(hexanoylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54840999 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | butyl 2-[1-[2-[3-(hexanoylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCC(=O)Nc1cccc(NCC(=O)N2CCNC(=O)C2CC(=O)OCCCC)c1 |
| InChI | InChI=1S/C24H36N4O5/c1-3-5-7-11-21(29)27-19-10-8-9-18(15-19)26-17-22(30)28-13-12-25-24(32)20(28)16-23(31)33-14-6-4-2/h8-10,15,20,26H,3-7,11-14,16-17H2,1-2H3,(H,25,32)(H,27,29) |
| InChIKey | GOPMRMAHXQYIOJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|