C22H26N4O6 — CID 54843567
propyl 2-[1-[2-[3-(furan-2-carbonylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54843567) has the molecular formula C22H26N4O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is propyl 2-[1-[2-[3-(furan-2-carbonylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-[3-(furan-2-carbonylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54843567 |
| Molecular Formula | C22H26N4O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | propyl 2-[1-[2-[3-(furan-2-carbonylamino)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C22H26N4O6/c1-2-10-32-20(28)13-17-21(29)23-8-9-26(17)19(27)14-24-15-5-3-6-16(12-15)25-22(30)18-7-4-11-31-18/h3-7,11-12,17,24H,2,8-10,13-14H2,1H3,(H,23,29)(H,25,30) |
| InChIKey | PGEMXUOCIMUWEF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |