C19H24F3N3O4 — CID 54833534
2-methylpropyl 2-[3-oxo-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-2-yl]acetate (PubChem CID 54833534) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-oxo-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[3-oxo-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54833534 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-methylpropyl 2-[3-oxo-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-2-yl]acetate |
| SMILES | CC(C)COC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N3O4/c1-12(2)11-29-17(27)9-15-18(28)23-6-7-25(15)16(26)10-24-14-5-3-4-13(8-14)19(20,21)22/h3-5,8,12,15,24H,6-7,9-11H2,1-2H3,(H,23,28) |
| InChIKey | FKMPQEKAKJROSX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |