C20H28N4O5 — CID 54822571
2-methylpropyl 2-[1-[2-(3-acetamidoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54822571) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-methylpropyl 2-[1-[2-(3-acetamidoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[1-[2-(3-acetamidoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54822571 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-methylpropyl 2-[1-[2-(3-acetamidoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(=O)Nc1cccc(NC(=O)CN2CCNC(=O)C2CC(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C20H28N4O5/c1-13(2)12-29-19(27)10-17-20(28)21-7-8-24(17)11-18(26)23-16-6-4-5-15(9-16)22-14(3)25/h4-6,9,13,17H,7-8,10-12H2,1-3H3,(H,21,28)(H,22,25)(H,23,26) |
| InChIKey | HXRDLLZBMSNMSO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |