C18H25N3O5 — CID 54819589
propyl 2-[1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54819589) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is propyl 2-[1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819589 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | propyl 2-[1-[2-(3-methoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C18H25N3O5/c1-3-9-26-17(23)11-15-18(24)19-7-8-21(15)12-16(22)20-13-5-4-6-14(10-13)25-2/h4-6,10,15H,3,7-9,11-12H2,1-2H3,(H,19,24)(H,20,22) |
| InChIKey | MFAFRIGKXSEHQA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |