C21H31N3O5 — CID 54819855
propyl 2-[1-[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54819855) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is propyl 2-[1-[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819855 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | propyl 2-[1-[2-[3-(2-methylpropoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(OCC(C)C)c1 |
| InChI | InChI=1S/C21H31N3O5/c1-4-10-28-20(26)12-18-21(27)22-8-9-24(18)13-19(25)23-16-6-5-7-17(11-16)29-14-15(2)3/h5-7,11,15,18H,4,8-10,12-14H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | BJYJLCQFCUZRGY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |