C26H33N3O6 — CID 54822312
2-methylpropyl 2-[3-oxo-1-[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]piperazin-2-yl]acetate (PubChem CID 54822312) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-methylpropyl 2-[3-oxo-1-[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]piperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[3-oxo-1-[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54822312 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-methylpropyl 2-[3-oxo-1-[2-oxo-2-[4-(2-phenoxyethoxy)anilino]ethyl]piperazin-2-yl]acetate |
| SMILES | CC(C)COC(=O)CC1C(=O)NCCN1CC(=O)Nc1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C26H33N3O6/c1-19(2)18-35-25(31)16-23-26(32)27-12-13-29(23)17-24(30)28-20-8-10-22(11-9-20)34-15-14-33-21-6-4-3-5-7-21/h3-11,19,23H,12-18H2,1-2H3,(H,27,32)(H,28,30) |
| InChIKey | FVCYZXYEKLSOMW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|