C22H33N3O5 — CID 54822905
butyl 2-[1-[2-(4-butoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54822905) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is butyl 2-[1-[2-(4-butoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-(4-butoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54822905 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | butyl 2-[1-[2-(4-butoxyanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C22H33N3O5/c1-3-5-13-29-18-9-7-17(8-10-18)24-20(26)16-25-12-11-23-22(28)19(25)15-21(27)30-14-6-4-2/h7-10,19H,3-6,11-16H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | QYIVYBIKBCFMJM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|