C23H33N3O6 — CID 54823027
butyl 2-[3-oxo-1-[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]piperazin-2-yl]acetate (PubChem CID 54823027) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is butyl 2-[3-oxo-1-[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]piperazin-2-yl]acetate.
| Compound Name | butyl 2-[3-oxo-1-[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54823027 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | butyl 2-[3-oxo-1-[2-oxo-2-[4-(oxolan-2-ylmethoxy)anilino]ethyl]piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H33N3O6/c1-2-3-12-31-22(28)14-20-23(29)24-10-11-26(20)15-21(27)25-17-6-8-18(9-7-17)32-16-19-5-4-13-30-19/h6-9,19-20H,2-5,10-16H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | IMXXBTTYAAEYSD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|