C18H26N4O4 — CID 54847688
2-[3-oxo-1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperazin-2-yl]acetohydrazide (PubChem CID 54847688) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[3-oxo-1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperazin-2-yl]acetohydrazide.
| Compound Name | 2-[3-oxo-1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 54847688 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[3-oxo-1-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]piperazin-2-yl]acetohydrazide |
| SMILES | NNC(=O)CC1C(=O)NCCN1Cc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C18H26N4O4/c19-21-17(23)10-16-18(24)20-7-8-22(16)11-13-3-5-14(6-4-13)26-12-15-2-1-9-25-15/h3-6,15-16H,1-2,7-12,19H2,(H,20,24)(H,21,23) |
| InChIKey | TYCJTQKQEOBKRD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|