C22H28N4O4 — CID 42095722
2-[(2R)-1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide (PubChem CID 42095722) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[(2R)-1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide.
| Compound Name | 2-[(2R)-1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 42095722 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 2-[(2R)-1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
| SMILES | CCOc1ccc(CN2CCNC(=O)[C@H]2CC(=O)NCCOc2cccnc2)cc1 |
| InChI | InChI=1S/C22H28N4O4/c1-2-29-18-7-5-17(6-8-18)16-26-12-10-25-22(28)20(26)14-21(27)24-11-13-30-19-4-3-9-23-15-19/h3-9,15,20H,2,10-14,16H2,1H3,(H,24,27)(H,25,28)/t20-/m1/s1 |
| InChIKey | YQHKVAKWFIPUGJ-HXUWFJFHSA-N |
| XLogP | 1.37 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|