C19H22N4O2 — CID 45206372
2-(1-benzyl-3-oxopiperazin-2-yl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 45206372) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(1-benzyl-3-oxopiperazin-2-yl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(1-benzyl-3-oxopiperazin-2-yl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 45206372 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-(1-benzyl-3-oxopiperazin-2-yl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1ccccc1)NCc1cccnc1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(22-13-16-7-4-8-20-12-16)11-17-19(25)21-9-10-23(17)14-15-5-2-1-3-6-15/h1-8,12,17H,9-11,13-14H2,(H,21,25)(H,22,24) |
| InChIKey | TVNFROIKYFMSIX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |