C18H22N4O2S — CID 45192808
2-[3-oxo-1-(pyridin-3-ylmethyl)piperazin-2-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 45192808) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-[3-oxo-1-(pyridin-3-ylmethyl)piperazin-2-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[3-oxo-1-(pyridin-3-ylmethyl)piperazin-2-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 45192808 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[3-oxo-1-(pyridin-3-ylmethyl)piperazin-2-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1cccnc1)NCCc1cccs1 |
| InChI | InChI=1S/C18H22N4O2S/c23-17(20-7-5-15-4-2-10-25-15)11-16-18(24)21-8-9-22(16)13-14-3-1-6-19-12-14/h1-4,6,10,12,16H,5,7-9,11,13H2,(H,20,23)(H,21,24) |
| InChIKey | DVPXHQVWCDHAPG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |