C19H22ClN3O2S — CID 45218563
N-[2-(3-chlorophenyl)ethyl]-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetamide (PubChem CID 45218563) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 45218563 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1cccs1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClN3O2S/c20-15-4-1-3-14(11-15)6-7-21-18(24)12-17-19(25)22-8-9-23(17)13-16-5-2-10-26-16/h1-5,10-11,17H,6-9,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | ZFXXCZYNLLZUHL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |