C13H17N7O2S — CID 95714026
2-[(2R)-3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-(2H-tetrazol-5-ylmethyl)acetamide (PubChem CID 95714026) has the molecular formula C13H17N7O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[(2R)-3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-(2H-tetrazol-5-ylmethyl)acetamide.
| Compound Name | 2-[(2R)-3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-(2H-tetrazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95714026 |
| Molecular Formula | C13H17N7O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(2R)-3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-(2H-tetrazol-5-ylmethyl)acetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1Cc1cccs1)NCc1nn[nH]n1 |
| InChI | InChI=1S/C13H17N7O2S/c21-12(15-7-11-16-18-19-17-11)6-10-13(22)14-3-4-20(10)8-9-2-1-5-23-9/h1-2,5,10H,3-4,6-8H2,(H,14,22)(H,15,21)(H,16,17,18,19)/t10-/m1/s1 |
| InChIKey | XMTBCMJRDYFNOZ-SNVBAGLBSA-N |
| XLogP | -0.73 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |