C18H29N3O2S — CID 56900851
N-ethyl-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-pentan-3-ylacetamide (PubChem CID 56900851) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-ethyl-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-pentan-3-ylacetamide.
| Compound Name | N-ethyl-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 56900851 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-ethyl-2-[3-oxo-1-(thiophen-2-ylmethyl)piperazin-2-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)N(CC)C(=O)CC1C(=O)NCCN1Cc1cccs1 |
| InChI | InChI=1S/C18H29N3O2S/c1-4-14(5-2)21(6-3)17(22)12-16-18(23)19-9-10-20(16)13-15-8-7-11-24-15/h7-8,11,14,16H,4-6,9-10,12-13H2,1-3H3,(H,19,23) |
| InChIKey | QEWHMNPVUXTFPM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |