C22H25F3N4O2 — CID 45211424
2-[3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide (PubChem CID 45211424) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-[3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide.
| Compound Name | 2-[3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide |
|---|---|
| PubChem CID | 45211424 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1cccc(C(F)(F)F)c1)NCCCc1cccnc1 |
| InChI | InChI=1S/C22H25F3N4O2/c23-22(24,25)18-7-1-4-17(12-18)15-29-11-10-28-21(31)19(29)13-20(30)27-9-3-6-16-5-2-8-26-14-16/h1-2,4-5,7-8,12,14,19H,3,6,9-11,13,15H2,(H,27,30)(H,28,31) |
| InChIKey | LRGKTHPEYJHBSL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|