C17H22F3N3O3 — CID 95715738
N-(3-hydroxypropyl)-2-[(2S)-3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide (PubChem CID 95715738) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-[(2S)-3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide.
| Compound Name | N-(3-hydroxypropyl)-2-[(2S)-3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 95715738 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(3-hydroxypropyl)-2-[(2S)-3-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]piperazin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1C(=O)NCCN1Cc1cccc(C(F)(F)F)c1)NCCCO |
| InChI | InChI=1S/C17H22F3N3O3/c18-17(19,20)13-4-1-3-12(9-13)11-23-7-6-22-16(26)14(23)10-15(25)21-5-2-8-24/h1,3-4,9,14,24H,2,5-8,10-11H2,(H,21,25)(H,22,26)/t14-/m0/s1 |
| InChIKey | SIIGBSDYAHESJV-AWEZNQCLSA-N |
| XLogP | 0.89 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|